C26H43NO — CID 142335394
methane;1-[(2S)-2,7,7,16-tetramethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethanone (PubChem CID 142335394) has the molecular formula C26H43NO and a molecular weight of 385.64 g/mol. Its IUPAC name is methane;1-[(2S)-2,7,7,16-tetramethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethanone.
| Compound Name | methane;1-[(2S)-2,7,7,16-tetramethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethanone |
|---|---|
| PubChem CID | 142335394 |
| Molecular Formula | C26H43NO |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 385.33 |
| IUPAC Name | methane;1-[(2S)-2,7,7,16-tetramethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethanone |
| SMILES | C.CNC1CCC23C(CCC4C5CC=C(C(C)=O)C5(C)CCC42[C@@H]3C)C1(C)C |
| InChI | InChI=1S/C25H39NO.CH4/c1-15(27)17-7-8-18-19-9-10-20-22(3,4)21(26-6)11-12-25(20)16(2)24(19,25)14-13-23(17,18)5;/h7,16,18-21,26H,8-14H2,1-6H3;1H4/t16-,18?,19?,20?,21?,23?,24?,25?;/m0./s1 |
| InChIKey | JDNRRTAJJRWRRD-PQDWHUPPSA-N |
| XLogP | 6.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |