C26H42N2O — CID 139380730
(NZ)-N-[1-[(1S,3R,6S,8R,11S,12S,16S)-6-(dimethylamino)-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethylidene]hydroxylamine (PubChem CID 139380730) has the molecular formula C26H42N2O and a molecular weight of 398.64 g/mol. Its IUPAC name is (NZ)-N-[1-[(1S,3R,6S,8R,11S,12S,16S)-6-(dimethylamino)-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[(1S,3R,6S,8R,11S,12S,16S)-6-(dimethylamino)-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 139380730 |
| Molecular Formula | C26H42N2O |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | (NZ)-N-[1-[(1S,3R,6S,8R,11S,12S,16S)-6-(dimethylamino)-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)C1=CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](N(C)C)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C26H42N2O/c1-17(27-29)18-10-12-24(5)20-9-8-19-22(2,3)21(28(6)7)11-13-25(19)16-26(20,25)15-14-23(18,24)4/h10,19-21,29H,8-9,11-16H2,1-7H3/b27-17-/t19-,20-,21-,23+,24-,25+,26-/m0/s1 |
| InChIKey | ZLHPKULZTWFHBC-AOPNOBLVSA-N |
| XLogP | 6.13 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|