C27H48N2 — CID 162914529
(1R,3S,6R,8S,11R,12S,15S,16R)-N,N,7,7,12,16-hexamethyl-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-amine (PubChem CID 162914529) has the molecular formula C27H48N2 and a molecular weight of 400.70 g/mol. Its IUPAC name is (1R,3S,6R,8S,11R,12S,15S,16R)-N,N,7,7,12,16-hexamethyl-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-amine.
| Compound Name | (1R,3S,6R,8S,11R,12S,15S,16R)-N,N,7,7,12,16-hexamethyl-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-amine |
|---|---|
| PubChem CID | 162914529 |
| Molecular Formula | C27H48N2 |
| Molecular Weight | 400.70 g/mol |
| Exact Mass | 400.38 |
| IUPAC Name | (1R,3S,6R,8S,11R,12S,15S,16R)-N,N,7,7,12,16-hexamethyl-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-amine |
| SMILES | CN[C@H](C)[C@H]1CC[C@@]2(C)[C@H]3CC[C@@H]4C(C)(C)[C@H](N(C)C)CC[C@]45C[C@]35CC[C@]12C |
| InChI | InChI=1S/C27H48N2/c1-18(28-6)19-11-13-25(5)21-10-9-20-23(2,3)22(29(7)8)12-14-26(20)17-27(21,26)16-15-24(19,25)4/h18-22,28H,9-17H2,1-8H3/t18-,19-,20-,21-,22-,24-,25+,26+,27-/m1/s1 |
| InChIKey | RXSFCOUBKQSZFV-CNIFTNMMSA-N |
| XLogP | 5.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.70 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |