C25H39NO — CID 162967140
(1S,3R,8R,11S,12S,15S,16R)-7,7,12,16-tetramethyl-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-en-6-one (PubChem CID 162967140) has the molecular formula C25H39NO and a molecular weight of 369.59 g/mol. Its IUPAC name is (1S,3R,8R,11S,12S,15S,16R)-7,7,12,16-tetramethyl-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-en-6-one.
| Compound Name | (1S,3R,8R,11S,12S,15S,16R)-7,7,12,16-tetramethyl-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-en-6-one |
|---|---|
| PubChem CID | 162967140 |
| Molecular Formula | C25H39NO |
| Molecular Weight | 369.59 g/mol |
| Exact Mass | 369.30 |
| IUPAC Name | (1S,3R,8R,11S,12S,15S,16R)-7,7,12,16-tetramethyl-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-en-6-one |
| SMILES | CN[C@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)C(=O)C=C[C@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C25H39NO/c1-16(26-6)17-9-11-23(5)19-8-7-18-21(2,3)20(27)10-12-24(18)15-25(19,24)14-13-22(17,23)4/h10,12,16-19,26H,7-9,11,13-15H2,1-6H3/t16-,17-,18+,19+,22-,23+,24+,25+/m1/s1 |
| InChIKey | AJAVHIZBCQNHJK-BQCMLFGMSA-N |
| XLogP | 5.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |