C30H44O2 — CID 162922379
(1S,3S,8R,11S,12S,15R,16R)-15-[(2R)-1-hydroxy-6-methylhepta-3,6-dien-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-en-6-one (PubChem CID 162922379) has the molecular formula C30H44O2 and a molecular weight of 436.68 g/mol. Its IUPAC name is (1S,3S,8R,11S,12S,15R,16R)-15-[(2R)-1-hydroxy-6-methylhepta-3,6-dien-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-en-6-one.
| Compound Name | (1S,3S,8R,11S,12S,15R,16R)-15-[(2R)-1-hydroxy-6-methylhepta-3,6-dien-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-en-6-one |
|---|---|
| PubChem CID | 162922379 |
| Molecular Formula | C30H44O2 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | (1S,3S,8R,11S,12S,15R,16R)-15-[(2R)-1-hydroxy-6-methylhepta-3,6-dien-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-en-6-one |
| SMILES | C=C(C)CC=C[C@@H](CO)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)C(=O)C=C[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C30H44O2/c1-20(2)8-7-9-21(18-31)22-12-14-28(6)24-11-10-23-26(3,4)25(32)13-15-29(23)19-30(24,29)17-16-27(22,28)5/h7,9,13,15,21-24,31H,1,8,10-12,14,16-19H2,2-6H3/t21-,22+,23-,24-,27+,28-,29+,30-/m0/s1 |
| InChIKey | JKNUAJLRQVKBPW-PYFPDXFRSA-N |
| XLogP | 6.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|