C25H37NO — CID 85170697
1-[7,7,12,16-tetramethyl-6-(methylamino)-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3,14-trienyl]ethanone (PubChem CID 85170697) has the molecular formula C25H37NO and a molecular weight of 367.58 g/mol. Its IUPAC name is 1-[7,7,12,16-tetramethyl-6-(methylamino)-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3,14-trienyl]ethanone.
| Compound Name | 1-[7,7,12,16-tetramethyl-6-(methylamino)-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3,14-trienyl]ethanone |
|---|---|
| PubChem CID | 85170697 |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | 1-[7,7,12,16-tetramethyl-6-(methylamino)-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3,14-trienyl]ethanone |
| SMILES | CNC1CC=C2CC3=CCC4(C)C(C(C)=O)=CCC4(C)C3CCC2C1(C)C |
| InChI | InChI=1S/C25H37NO/c1-16(27)19-12-14-25(5)21-9-8-20-17(7-10-22(26-6)23(20,2)3)15-18(21)11-13-24(19,25)4/h7,11-12,20-22,26H,8-10,13-15H2,1-6H3 |
| InChIKey | ZISLXYPNMCQAMV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|