C35H48N2O5 — CID 101421923
[(6S,7R,8R,9S,11R,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-7-formyl-9-hydroxy-7,12,16-trimethyl-14-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3-dienyl] acetate (PubChem CID 101421923) has the molecular formula C35H48N2O5 and a molecular weight of 576.78 g/mol. Its IUPAC name is [(6S,7R,8R,9S,11R,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-7-formyl-9-hydroxy-7,12,16-trimethyl-14-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3-dienyl] acetate.
| Compound Name | [(6S,7R,8R,9S,11R,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-7-formyl-9-hydroxy-7,12,16-trimethyl-14-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3-dienyl] acetate |
|---|---|
| PubChem CID | 101421923 |
| Molecular Formula | C35H48N2O5 |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | [(6S,7R,8R,9S,11R,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-7-formyl-9-hydroxy-7,12,16-trimethyl-14-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3-dienyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]2(C)[C@@H]3C[C@H](O)[C@@H]4C(=CC[C@H](NC(=O)c5ccccc5)[C@]4(C)C=O)CC3=CC[C@]2(C)[C@H]1[C@H](C)N(C)C |
| InChI | InChI=1S/C35H48N2O5/c1-21(37(6)7)30-28(42-22(2)39)19-35(5)26-18-27(40)31-25(17-24(26)15-16-34(30,35)4)13-14-29(33(31,3)20-38)36-32(41)23-11-9-8-10-12-23/h8-13,15,20-21,26-31,40H,14,16-19H2,1-7H3,(H,36,41)/t21-,26+,27-,28+,29-,30-,31-,33-,34+,35-/m0/s1 |
| InChIKey | VYNQRHYSCBDBNY-WRIOLOASSA-N |
| XLogP | 4.95 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|