C35H50N2O4 — CID 162980789
[(6S,7R,8R,11R,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-14-hydroxy-7,12,16-trimethyl-7-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dienyl]methyl acetate (PubChem CID 162980789) has the molecular formula C35H50N2O4 and a molecular weight of 562.80 g/mol. Its IUPAC name is [(6S,7R,8R,11R,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-14-hydroxy-7,12,16-trimethyl-7-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dienyl]methyl acetate.
| Compound Name | [(6S,7R,8R,11R,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-14-hydroxy-7,12,16-trimethyl-7-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dienyl]methyl acetate |
|---|---|
| PubChem CID | 162980789 |
| Molecular Formula | C35H50N2O4 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.38 |
| IUPAC Name | [(6S,7R,8R,11R,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-14-hydroxy-7,12,16-trimethyl-7-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dienyl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)[C@@H](NC(=O)c2ccccc2)CCC2=CC3=CC[C@]4(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@@]4(C)[C@@H]3CC[C@H]21 |
| InChI | InChI=1S/C35H50N2O4/c1-22(37(6)7)31-29(39)20-35(5)28-15-14-27-25(19-26(28)17-18-34(31,35)4)13-16-30(33(27,3)21-41-23(2)38)36-32(40)24-11-9-8-10-12-24/h8-12,17,19,22,27-31,39H,13-16,18,20-21H2,1-7H3,(H,36,40)/t22-,27+,28+,29+,30-,31-,33+,34+,35-/m0/s1 |
| InChIKey | DNYDYJVMCPIMMQ-BZTLBABMSA-N |
| XLogP | 5.77 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |