C35H48N2O5 — CID 50908831
[(1R,4S,6R,7S,8R,13S,16S,17R,20R)-16-benzamido-7-[1-(dimethylamino)ethyl]-13-hydroxy-4,8,17-trimethyl-19-oxapentacyclo[11.6.1.03,11.04,8.017,20]icosa-10,14-dien-6-yl] acetate (PubChem CID 50908831) has the molecular formula C35H48N2O5 and a molecular weight of 576.78 g/mol. Its IUPAC name is [(1R,4S,6R,7S,8R,13S,16S,17R,20R)-16-benzamido-7-[1-(dimethylamino)ethyl]-13-hydroxy-4,8,17-trimethyl-19-oxapentacyclo[11.6.1.03,11.04,8.017,20]icosa-10,14-dien-6-yl] acetate.
| Compound Name | [(1R,4S,6R,7S,8R,13S,16S,17R,20R)-16-benzamido-7-[1-(dimethylamino)ethyl]-13-hydroxy-4,8,17-trimethyl-19-oxapentacyclo[11.6.1.03,11.04,8.017,20]icosa-10,14-dien-6-yl] acetate |
|---|---|
| PubChem CID | 50908831 |
| Molecular Formula | C35H48N2O5 |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | [(1R,4S,6R,7S,8R,13S,16S,17R,20R)-16-benzamido-7-[1-(dimethylamino)ethyl]-13-hydroxy-4,8,17-trimethyl-19-oxapentacyclo[11.6.1.03,11.04,8.017,20]icosa-10,14-dien-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]2(C)C3C[C@H]4OC[C@@]5(C)[C@@H](NC(=O)c6ccccc6)C=C[C@@](O)(CC3=CC[C@]2(C)[C@H]1C(C)N(C)C)[C@@H]45 |
| InChI | InChI=1S/C35H48N2O5/c1-21(37(6)7)29-27(42-22(2)38)19-34(5)25-17-26-30-32(3,20-41-26)28(36-31(39)23-11-9-8-10-12-23)14-16-35(30,40)18-24(25)13-15-33(29,34)4/h8-14,16,21,25-30,40H,15,17-20H2,1-7H3,(H,36,39)/t21?,25?,26-,27-,28+,29+,30+,32+,33-,34+,35-/m1/s1 |
| InChIKey | VCPJZJYGJJULKC-AIEWICKQSA-N |
| XLogP | 4.76 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|