C36H54N2O4 — CID 5491700
[(1R,6S,7S,8R,11R,12S,14R,15S,16R)-6-[benzoyl(methyl)amino]-15-[(1S)-1-(dimethylamino)ethyl]-7-(hydroxymethyl)-7,12,16-trimethyl-14-tetracyclo[9.7.0.03,8.012,16]octadec-3-enyl] acetate (PubChem CID 5491700) has the molecular formula C36H54N2O4 and a molecular weight of 578.84 g/mol. Its IUPAC name is [(1R,6S,7S,8R,11R,12S,14R,15S,16R)-6-[benzoyl(methyl)amino]-15-[(1S)-1-(dimethylamino)ethyl]-7-(hydroxymethyl)-7,12,16-trimethyl-14-tetracyclo[9.7.0.03,8.012,16]octadec-3-enyl] acetate.
| Compound Name | [(1R,6S,7S,8R,11R,12S,14R,15S,16R)-6-[benzoyl(methyl)amino]-15-[(1S)-1-(dimethylamino)ethyl]-7-(hydroxymethyl)-7,12,16-trimethyl-14-tetracyclo[9.7.0.03,8.012,16]octadec-3-enyl] acetate |
|---|---|
| PubChem CID | 5491700 |
| Molecular Formula | C36H54N2O4 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.41 |
| IUPAC Name | [(1R,6S,7S,8R,11R,12S,14R,15S,16R)-6-[benzoyl(methyl)amino]-15-[(1S)-1-(dimethylamino)ethyl]-7-(hydroxymethyl)-7,12,16-trimethyl-14-tetracyclo[9.7.0.03,8.012,16]octadec-3-enyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]2(C)[C@@H]3CC[C@@H]4C(=CC[C@H](N(C)C(=O)c5ccccc5)[C@@]4(C)CO)C[C@H]3CC[C@]2(C)[C@H]1[C@H](C)N(C)C |
| InChI | InChI=1S/C36H54N2O4/c1-23(37(6)7)32-30(42-24(2)40)21-36(5)29-16-15-28-26(20-27(29)18-19-35(32,36)4)14-17-31(34(28,3)22-39)38(8)33(41)25-12-10-9-11-13-25/h9-14,23,27-32,39H,15-22H2,1-8H3/t23-,27+,28+,29+,30+,31-,32-,34-,35+,36-/m0/s1 |
| InChIKey | GVPKAHHAVRQDCN-NXEZQSRVSA-N |
| XLogP | 6.20 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|