C28H46N2 — CID 162873388
N,7,7,12,16-pentamethyl-15-[1-(propan-2-ylideneamino)ethyl]tetracyclo[9.7.0.03,8.012,16]octadeca-1,3-dien-6-amine (PubChem CID 162873388) has the molecular formula C28H46N2 and a molecular weight of 410.69 g/mol. Its IUPAC name is N,7,7,12,16-pentamethyl-15-[1-(propan-2-ylideneamino)ethyl]tetracyclo[9.7.0.03,8.012,16]octadeca-1,3-dien-6-amine.
| Compound Name | N,7,7,12,16-pentamethyl-15-[1-(propan-2-ylideneamino)ethyl]tetracyclo[9.7.0.03,8.012,16]octadeca-1,3-dien-6-amine |
|---|---|
| PubChem CID | 162873388 |
| Molecular Formula | C28H46N2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.37 |
| IUPAC Name | N,7,7,12,16-pentamethyl-15-[1-(propan-2-ylideneamino)ethyl]tetracyclo[9.7.0.03,8.012,16]octadeca-1,3-dien-6-amine |
| SMILES | CNC1CC=C2C=C3CCC4(C)C(C(C)N=C(C)C)CCC4(C)C3CCC2C1(C)C |
| InChI | InChI=1S/C28H46N2/c1-18(2)30-19(3)22-14-16-28(7)24-11-10-23-20(9-12-25(29-8)26(23,4)5)17-21(24)13-15-27(22,28)6/h9,17,19,22-25,29H,10-16H2,1-8H3 |
| InChIKey | OGGMJUADVUDJGQ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|