C27H41NO3 — CID 162950313
ethyl N-[(1S,3R,6S,8R,11S,12S,16S)-15-ethylidene-7,7,12,16-tetramethyl-14-oxo-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]carbamate (PubChem CID 162950313) has the molecular formula C27H41NO3 and a molecular weight of 427.63 g/mol. Its IUPAC name is ethyl N-[(1S,3R,6S,8R,11S,12S,16S)-15-ethylidene-7,7,12,16-tetramethyl-14-oxo-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]carbamate.
| Compound Name | ethyl N-[(1S,3R,6S,8R,11S,12S,16S)-15-ethylidene-7,7,12,16-tetramethyl-14-oxo-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]carbamate |
|---|---|
| PubChem CID | 162950313 |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | ethyl N-[(1S,3R,6S,8R,11S,12S,16S)-15-ethylidene-7,7,12,16-tetramethyl-14-oxo-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]carbamate |
| SMILES | CC=C1C(=O)C[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](NC(=O)OCC)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C27H41NO3/c1-7-17-18(29)15-25(6)20-10-9-19-23(3,4)21(28-22(30)31-8-2)11-12-26(19)16-27(20,26)14-13-24(17,25)5/h7,19-21H,8-16H2,1-6H3,(H,28,30)/t19-,20-,21-,24+,25-,26+,27-/m0/s1 |
| InChIKey | RAXVMQSGYOTCDT-KMGAEVTHSA-N |
| XLogP | 6.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|