C28H48O2 — CID 145498721
2-methyl-6-[(12S)-7,12,16-trimethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]hexane-2,3-diol (PubChem CID 145498721) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is 2-methyl-6-[(12S)-7,12,16-trimethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]hexane-2,3-diol.
| Compound Name | 2-methyl-6-[(12S)-7,12,16-trimethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]hexane-2,3-diol |
|---|---|
| PubChem CID | 145498721 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | 2-methyl-6-[(12S)-7,12,16-trimethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]hexane-2,3-diol |
| SMILES | CC1CCCC23CC24CCC2(C)C(CCCC(O)C(C)(C)O)CC[C@@]2(C)C4CCC13 |
| InChI | InChI=1S/C28H48O2/c1-19-8-7-14-27-18-28(27)17-16-25(4)20(9-6-10-23(29)24(2,3)30)13-15-26(25,5)22(28)12-11-21(19)27/h19-23,29-30H,6-18H2,1-5H3/t19?,20?,21?,22?,23?,25?,26-,27?,28?/m0/s1 |
| InChIKey | LXQFKRWVJFYIIK-UDNQXCLYSA-N |
| XLogP | 6.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |