C30H50O2 — CID 75148907
15-(6-hydroxy-6-methylhept-4-enyl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol (PubChem CID 75148907) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is 15-(6-hydroxy-6-methylhept-4-enyl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol.
| Compound Name | 15-(6-hydroxy-6-methylhept-4-enyl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol |
|---|---|
| PubChem CID | 75148907 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | 15-(6-hydroxy-6-methylhept-4-enyl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol |
| SMILES | CC(C)(O)C=CCCCC1CCC2(C)C3CCC4C(C)(C)C(O)CCC45CC35CCC12C |
| InChI | InChI=1S/C30H50O2/c1-25(2,32)15-9-7-8-10-21-13-16-28(6)23-12-11-22-26(3,4)24(31)14-17-29(22)20-30(23,29)19-18-27(21,28)5/h9,15,21-24,31-32H,7-8,10-14,16-20H2,1-6H3 |
| InChIKey | NLUYLGZZDKVAJG-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|