C30H50O3 — CID 163006647
15-(6-hydroxy-6-methylhept-4-en-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-4,6-diol (PubChem CID 163006647) has the molecular formula C30H50O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is 15-(6-hydroxy-6-methylhept-4-en-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-4,6-diol.
| Compound Name | 15-(6-hydroxy-6-methylhept-4-en-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-4,6-diol |
|---|---|
| PubChem CID | 163006647 |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | 15-(6-hydroxy-6-methylhept-4-en-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-4,6-diol |
| SMILES | CC(CC=CC(C)(C)O)C1CCC2(C)C3CCC4C(C)(C)C(O)CC(O)C45CC35CCC12C |
| InChI | InChI=1S/C30H50O3/c1-19(9-8-13-25(2,3)33)20-12-14-28(7)22-11-10-21-26(4,5)23(31)17-24(32)30(21)18-29(22,30)16-15-27(20,28)6/h8,13,19-24,31-33H,9-12,14-18H2,1-7H3 |
| InChIKey | JRZVIXPQDXVQMN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|