C30H52O5 — CID 162992108
15-(5,6-dihydroxy-6-methylheptan-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-4,6,10-triol (PubChem CID 162992108) has the molecular formula C30H52O5 and a molecular weight of 492.74 g/mol. Its IUPAC name is 15-(5,6-dihydroxy-6-methylheptan-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-4,6,10-triol.
| Compound Name | 15-(5,6-dihydroxy-6-methylheptan-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-4,6,10-triol |
|---|---|
| PubChem CID | 162992108 |
| Molecular Formula | C30H52O5 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.38 |
| IUPAC Name | 15-(5,6-dihydroxy-6-methylheptan-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-4,6,10-triol |
| SMILES | CC(CCC(O)C(C)(C)O)C1CCC2(C)C3C(O)CC4C(C)(C)C(O)CC(O)C45CC35CCC12C |
| InChI | InChI=1S/C30H52O5/c1-17(8-9-21(32)26(4,5)35)18-10-11-28(7)24-19(31)14-20-25(2,3)22(33)15-23(34)30(20)16-29(24,30)13-12-27(18,28)6/h17-24,31-35H,8-16H2,1-7H3 |
| InChIKey | SKQXIRAMSJKHTH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |