C37H22N6O — CID 139525045
9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14-oxa-4,6,9-triazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (PubChem CID 139525045) has the molecular formula C37H22N6O and a molecular weight of 566.62 g/mol. Its IUPAC name is 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14-oxa-4,6,9-triazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene.
| Compound Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14-oxa-4,6,9-triazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 139525045 |
| Molecular Formula | C37H22N6O |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14-oxa-4,6,9-triazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-n4c5cncnc5c5c6c(ccc54)oc4ccccc46)c3)n2)cc1 |
| InChI | InChI=1S/C37H22N6O/c1-3-10-23(11-4-1)35-40-36(24-12-5-2-6-13-24)42-37(41-35)25-14-9-15-26(20-25)43-28-18-19-31-32(27-16-7-8-17-30(27)44-31)33(28)34-29(43)21-38-22-39-34/h1-22H |
| InChIKey | MYMGXVMUYPVCNG-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |