C23H14BrN — CID 139525986
4-[4-(2-bromonaphthalen-1-yl)phenyl]benzonitrile (PubChem CID 139525986) has the molecular formula C23H14BrN and a molecular weight of 384.28 g/mol. Its IUPAC name is 4-[4-(2-bromonaphthalen-1-yl)phenyl]benzonitrile.
| Compound Name | 4-[4-(2-bromonaphthalen-1-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 139525986 |
| Molecular Formula | C23H14BrN |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 4-[4-(2-bromonaphthalen-1-yl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3c(Br)ccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C23H14BrN/c24-22-14-13-19-3-1-2-4-21(19)23(22)20-11-9-18(10-12-20)17-7-5-16(15-25)6-8-17/h1-14H |
| InChIKey | KBFHJYGXZQKHQF-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |