C17H11BrN2 — CID 126544908
4-[3-(bromomethyl)isoquinolin-4-yl]benzonitrile (PubChem CID 126544908) has the molecular formula C17H11BrN2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 4-[3-(bromomethyl)isoquinolin-4-yl]benzonitrile.
| Compound Name | 4-[3-(bromomethyl)isoquinolin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 126544908 |
| Molecular Formula | C17H11BrN2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 4-[3-(bromomethyl)isoquinolin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c(CBr)ncc3ccccc23)cc1 |
| InChI | InChI=1S/C17H11BrN2/c18-9-16-17(13-7-5-12(10-19)6-8-13)15-4-2-1-3-14(15)11-20-16/h1-8,11H,9H2 |
| InChIKey | DEIINMFTXPAKLS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|