C23H31ClN2O3 — CID 139528407
tert-butyl 3-[2-(5-chloro-1H-indazol-7-yl)-2-hydroxyspiro[3.5]nonan-7-yl]propanoate (PubChem CID 139528407) has the molecular formula C23H31ClN2O3 and a molecular weight of 418.97 g/mol. Its IUPAC name is tert-butyl 3-[2-(5-chloro-1H-indazol-7-yl)-2-hydroxyspiro[3.5]nonan-7-yl]propanoate.
| Compound Name | tert-butyl 3-[2-(5-chloro-1H-indazol-7-yl)-2-hydroxyspiro[3.5]nonan-7-yl]propanoate |
|---|---|
| PubChem CID | 139528407 |
| Molecular Formula | C23H31ClN2O3 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | tert-butyl 3-[2-(5-chloro-1H-indazol-7-yl)-2-hydroxyspiro[3.5]nonan-7-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCC1CCC2(CC1)CC(O)(c1cc(Cl)cc3cn[nH]c13)C2 |
| InChI | InChI=1S/C23H31ClN2O3/c1-21(2,3)29-19(27)5-4-15-6-8-22(9-7-15)13-23(28,14-22)18-11-17(24)10-16-12-25-26-20(16)18/h10-12,15,28H,4-9,13-14H2,1-3H3,(H,25,26) |
| InChIKey | UHUKHTDRFAQPET-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |