C26H31ClFN3O3 — CID 68841540
tert-butyl 4-[2-(5-chloro-1H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylate (PubChem CID 68841540) has the molecular formula C26H31ClFN3O3 and a molecular weight of 488.00 g/mol. Its IUPAC name is tert-butyl 4-[2-(5-chloro-1H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(5-chloro-1H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68841540 |
| Molecular Formula | C26H31ClFN3O3 |
| Molecular Weight | 488.00 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | tert-butyl 4-[2-(5-chloro-1H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COCCc2cc(Cl)cc3cn[nH]c23)(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H31ClFN3O3/c1-25(2,3)34-24(32)31-11-9-26(10-12-31,20-4-6-22(28)7-5-20)17-33-13-8-18-14-21(27)15-19-16-29-30-23(18)19/h4-7,14-16H,8-13,17H2,1-3H3,(H,29,30) |
| InChIKey | VQZILXDJPQBXFO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.00 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|