C32H44BrClFN3O4Si — CID 68842048
tert-butyl 4-[2-[3-bromo-5-chloro-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylate (PubChem CID 68842048) has the molecular formula C32H44BrClFN3O4Si and a molecular weight of 697.16 g/mol. Its IUPAC name is tert-butyl 4-[2-[3-bromo-5-chloro-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[3-bromo-5-chloro-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68842048 |
| Molecular Formula | C32H44BrClFN3O4Si |
| Molecular Weight | 697.16 g/mol |
| Exact Mass | 695.20 |
| IUPAC Name | tert-butyl 4-[2-[3-bromo-5-chloro-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COCCc2cc(Cl)cc3c(Br)n(COCC[Si](C)(C)C)nc23)(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C32H44BrClFN3O4Si/c1-31(2,3)42-30(39)37-14-12-32(13-15-37,24-7-9-26(35)10-8-24)21-40-16-11-23-19-25(34)20-27-28(23)36-38(29(27)33)22-41-17-18-43(4,5)6/h7-10,19-20H,11-18,21-22H2,1-6H3 |
| InChIKey | RGKITKCHODCPEF-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.16 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|