C29H37BrF3N3O4Si — CID 67403489
4-[1-[3-bromo-5-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]ethoxymethyl]-4-phenylpiperidine-1-carboxylic acid (PubChem CID 67403489) has the molecular formula C29H37BrF3N3O4Si and a molecular weight of 656.62 g/mol. Its IUPAC name is 4-[1-[3-bromo-5-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]ethoxymethyl]-4-phenylpiperidine-1-carboxylic acid.
| Compound Name | 4-[1-[3-bromo-5-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]ethoxymethyl]-4-phenylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67403489 |
| Molecular Formula | C29H37BrF3N3O4Si |
| Molecular Weight | 656.62 g/mol |
| Exact Mass | 655.17 |
| IUPAC Name | 4-[1-[3-bromo-5-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]ethoxymethyl]-4-phenylpiperidine-1-carboxylic acid |
| SMILES | CC(OCC1(c2ccccc2)CCN(C(=O)O)CC1)c1cc(C(F)(F)F)cc2c(Br)n(COCC[Si](C)(C)C)nc12 |
| InChI | InChI=1S/C29H37BrF3N3O4Si/c1-20(40-18-28(21-8-6-5-7-9-21)10-12-35(13-11-28)27(37)38)23-16-22(29(31,32)33)17-24-25(23)34-36(26(24)30)19-39-14-15-41(2,3)4/h5-9,16-17,20H,10-15,18-19H2,1-4H3,(H,37,38) |
| InChIKey | MJLTWEHDHQMYFF-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.62 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|