C29H39ClFN3O5Si — CID 67405171
4-[[1-[5-chloro-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]-2-methoxyethoxy]methyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid (PubChem CID 67405171) has the molecular formula C29H39ClFN3O5Si and a molecular weight of 592.18 g/mol. Its IUPAC name is 4-[[1-[5-chloro-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]-2-methoxyethoxy]methyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid.
| Compound Name | 4-[[1-[5-chloro-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]-2-methoxyethoxy]methyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67405171 |
| Molecular Formula | C29H39ClFN3O5Si |
| Molecular Weight | 592.18 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | 4-[[1-[5-chloro-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]-2-methoxyethoxy]methyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid |
| SMILES | COCC(OCC1(c2ccc(F)cc2)CCN(C(=O)O)CC1)c1cc(Cl)cc2cn(COCC[Si](C)(C)C)nc12 |
| InChI | InChI=1S/C29H39ClFN3O5Si/c1-37-18-26(25-16-23(30)15-21-17-34(32-27(21)25)20-38-13-14-40(2,3)4)39-19-29(22-5-7-24(31)8-6-22)9-11-33(12-10-29)28(35)36/h5-8,15-17,26H,9-14,18-20H2,1-4H3,(H,35,36) |
| InChIKey | NDNZKFYUQZFTKE-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.18 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|