C33H44ClFN4O4Si — CID 68843106
tert-butyl 4-[[2-[5-chloro-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]-2-cyanoethoxy]methyl]-4-(4-fluorophenyl)piperidine-1-carboxylate (PubChem CID 68843106) has the molecular formula C33H44ClFN4O4Si and a molecular weight of 643.28 g/mol. Its IUPAC name is tert-butyl 4-[[2-[5-chloro-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]-2-cyanoethoxy]methyl]-4-(4-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[5-chloro-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]-2-cyanoethoxy]methyl]-4-(4-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68843106 |
| Molecular Formula | C33H44ClFN4O4Si |
| Molecular Weight | 643.28 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | tert-butyl 4-[[2-[5-chloro-2-(2-trimethylsilylethoxymethyl)indazol-7-yl]-2-cyanoethoxy]methyl]-4-(4-fluorophenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COCC(C#N)c2cc(Cl)cc3cn(COCC[Si](C)(C)C)nc23)(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C33H44ClFN4O4Si/c1-32(2,3)43-31(40)38-13-11-33(12-14-38,26-7-9-28(35)10-8-26)22-42-21-25(19-36)29-18-27(34)17-24-20-39(37-30(24)29)23-41-15-16-44(4,5)6/h7-10,17-18,20,25H,11-16,21-23H2,1-6H3 |
| InChIKey | PFILNJWADXCMND-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 89.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.28 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|