C19H22ClFN2O4 — CID 91424142
tert-butyl 4-(3-chloro-4-fluorophenyl)-4-(2-cyanato-2-oxoethyl)piperidine-1-carboxylate (PubChem CID 91424142) has the molecular formula C19H22ClFN2O4 and a molecular weight of 396.85 g/mol. Its IUPAC name is tert-butyl 4-(3-chloro-4-fluorophenyl)-4-(2-cyanato-2-oxoethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-chloro-4-fluorophenyl)-4-(2-cyanato-2-oxoethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91424142 |
| Molecular Formula | C19H22ClFN2O4 |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | tert-butyl 4-(3-chloro-4-fluorophenyl)-4-(2-cyanato-2-oxoethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC(=O)OC#N)(c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H22ClFN2O4/c1-18(2,3)27-17(25)23-8-6-19(7-9-23,11-16(24)26-12-22)13-4-5-15(21)14(20)10-13/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | SHPKYIHMNNBGTG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|