C18H23ClN2O2 — CID 11602444
tert-butyl 4-(3-chlorophenyl)-4-(cyanomethyl)piperidine-1-carboxylate (PubChem CID 11602444) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is tert-butyl 4-(3-chlorophenyl)-4-(cyanomethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-chlorophenyl)-4-(cyanomethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11602444 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | tert-butyl 4-(3-chlorophenyl)-4-(cyanomethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC#N)(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H23ClN2O2/c1-17(2,3)23-16(22)21-11-8-18(7-10-20,9-12-21)14-5-4-6-15(19)13-14/h4-6,13H,7-9,11-12H2,1-3H3 |
| InChIKey | IBKOZWKGPNRCEZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |