C31H41ClFN3O4Si — CID 67403925
4-[1-[5-chloro-3-cyclopropyl-1-(2-trimethylsilylethoxymethyl)indazol-7-yl]ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid (PubChem CID 67403925) has the molecular formula C31H41ClFN3O4Si and a molecular weight of 602.22 g/mol. Its IUPAC name is 4-[1-[5-chloro-3-cyclopropyl-1-(2-trimethylsilylethoxymethyl)indazol-7-yl]ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid.
| Compound Name | 4-[1-[5-chloro-3-cyclopropyl-1-(2-trimethylsilylethoxymethyl)indazol-7-yl]ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67403925 |
| Molecular Formula | C31H41ClFN3O4Si |
| Molecular Weight | 602.22 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 4-[1-[5-chloro-3-cyclopropyl-1-(2-trimethylsilylethoxymethyl)indazol-7-yl]ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid |
| SMILES | CC(OCC1(c2ccc(F)cc2)CCN(C(=O)O)CC1)c1cc(Cl)cc2c(C3CC3)nn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C31H41ClFN3O4Si/c1-21(40-19-31(23-7-9-25(33)10-8-23)11-13-35(14-12-31)30(37)38)26-17-24(32)18-27-28(22-5-6-22)34-36(29(26)27)20-39-15-16-41(2,3)4/h7-10,17-18,21-22H,5-6,11-16,19-20H2,1-4H3,(H,37,38) |
| InChIKey | ZODHDYOIIOAXLE-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.22 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|