About 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid
4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid (PubChem CID 67403820) has the molecular formula C22H22Br2FN3O3
and a molecular weight of 555.24 g/mol. Its IUPAC name is 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid |
| PubChem CID | 67403820 |
| Molecular Formula | C22H22Br2FN3O3 |
| Molecular Weight | 555.24 g/mol |
| Exact Mass | 553.00 |
| IUPAC Name | 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid |
| SMILES | CC(OCC1(c2ccc(F)cc2)CCN(C(=O)O)CC1)c1cc(Br)cc2c(Br)[nH]nc12 |
| InChI | InChI=1S/C22H22Br2FN3O3/c1-13(17-10-15(23)11-18-19(17)26-27-20(18)24)31-12-22(14-2-4-16(25)5-3-14)6-8-28(9-7-22)21(29)30/h2-5,10-11,13H,6-9,12H2,1H3,(H,26,27)(H,29,30) |
| InChIKey | SILUKZSKLITPIJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.24 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid?
The IUPAC name of 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid (CID 67403820) is 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid.
What is the SMILES notation for 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid?
The canonical SMILES for 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid is CC(OCC1(c2ccc(F)cc2)CCN(C(=O)O)CC1)c1cc(Br)cc2c(Br)[nH]nc12.
What is the InChIKey of 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid?
The InChIKey is SILUKZSKLITPIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22Br2FN3O3/c1-13(17-10-15(23)11-18-19(17)26-27-20(18)24)31-12-22(14-2-4-16(25)5-3-14)6-8-28(9-7-22)21(29)30/h2-5,10-11,13H,6-9,12H2,1H3,(H,26,27)(H,29,30).
What are the key properties of 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid?
4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid has a molecular weight of 555.24 g/mol, XLogP of 6.02, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,5-dibromo-2H-indazol-7-yl)ethoxymethyl]-4-(4-fluorophenyl)piperidine-1-carboxylic acid is sourced from PubChem (CID 67403820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).