C17H19BrO3S — CID 139531661
methyl 4-[5-(3-bromopropyl)-6-methyl-1-benzothiophen-2-yl]-4-oxobutanoate (PubChem CID 139531661) has the molecular formula C17H19BrO3S and a molecular weight of 383.31 g/mol. Its IUPAC name is methyl 4-[5-(3-bromopropyl)-6-methyl-1-benzothiophen-2-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[5-(3-bromopropyl)-6-methyl-1-benzothiophen-2-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 139531661 |
| Molecular Formula | C17H19BrO3S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | methyl 4-[5-(3-bromopropyl)-6-methyl-1-benzothiophen-2-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1cc2cc(CCCBr)c(C)cc2s1 |
| InChI | InChI=1S/C17H19BrO3S/c1-11-8-15-13(9-12(11)4-3-7-18)10-16(22-15)14(19)5-6-17(20)21-2/h8-10H,3-7H2,1-2H3 |
| InChIKey | LSYXZXUPQRKIKS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|