C13H8F3IN4O — CID 139532637
3-[4-[(4-iodopyrazol-1-yl)methyl]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole (PubChem CID 139532637) has the molecular formula C13H8F3IN4O and a molecular weight of 420.13 g/mol. Its IUPAC name is 3-[4-[(4-iodopyrazol-1-yl)methyl]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-[(4-iodopyrazol-1-yl)methyl]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 139532637 |
| Molecular Formula | C13H8F3IN4O |
| Molecular Weight | 420.13 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 3-[4-[(4-iodopyrazol-1-yl)methyl]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1nc(-c2ccc(Cn3cc(I)cn3)cc2)no1 |
| InChI | InChI=1S/C13H8F3IN4O/c14-13(15,16)12-19-11(20-22-12)9-3-1-8(2-4-9)6-21-7-10(17)5-18-21/h1-5,7H,6H2 |
| InChIKey | DRUBWQXPDXOMMO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.13 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|