C16H14F3N5O2 — CID 155179224
(E)-N-methoxy-2-[1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]pyrazol-4-yl]ethanimine (PubChem CID 155179224) has the molecular formula C16H14F3N5O2 and a molecular weight of 365.32 g/mol. Its IUPAC name is (E)-N-methoxy-2-[1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]pyrazol-4-yl]ethanimine.
| Compound Name | (E)-N-methoxy-2-[1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]pyrazol-4-yl]ethanimine |
|---|---|
| PubChem CID | 155179224 |
| Molecular Formula | C16H14F3N5O2 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (E)-N-methoxy-2-[1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]pyrazol-4-yl]ethanimine |
| SMILES | CO/N=C/Cc1cnn(Cc2ccc(-c3noc(C(F)(F)F)n3)cc2)c1 |
| InChI | InChI=1S/C16H14F3N5O2/c1-25-21-7-6-12-8-20-24(10-12)9-11-2-4-13(5-3-11)14-22-15(26-23-14)16(17,18)19/h2-5,7-8,10H,6,9H2,1H3/b21-7+ |
| InChIKey | ABWMXZHJPOJQHN-QPSGOUHRSA-N |
| XLogP | 3.17 |
| TPSA | 78.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|