C16H31NO2 — CID 139533485
tert-butyl 2-methyl-3,3-dipropylpyrrolidine-1-carboxylate (PubChem CID 139533485) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is tert-butyl 2-methyl-3,3-dipropylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-methyl-3,3-dipropylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139533485 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | tert-butyl 2-methyl-3,3-dipropylpyrrolidine-1-carboxylate |
| SMILES | CCCC1(CCC)CCN(C(=O)OC(C)(C)C)C1C |
| InChI | InChI=1S/C16H31NO2/c1-7-9-16(10-8-2)11-12-17(13(16)3)14(18)19-15(4,5)6/h13H,7-12H2,1-6H3 |
| InChIKey | YTKUKOVEHGEARD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |