C16H32O4 — CID 139535222
hydroxy 2-butyl-2-ethyl-3,3,5,5-tetramethylhexaneperoxoate (PubChem CID 139535222) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is hydroxy 2-butyl-2-ethyl-3,3,5,5-tetramethylhexaneperoxoate.
| Compound Name | hydroxy 2-butyl-2-ethyl-3,3,5,5-tetramethylhexaneperoxoate |
|---|---|
| PubChem CID | 139535222 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | hydroxy 2-butyl-2-ethyl-3,3,5,5-tetramethylhexaneperoxoate |
| SMILES | CCCCC(CC)(C(=O)OOO)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H32O4/c1-8-10-11-16(9-2,13(17)19-20-18)15(6,7)12-14(3,4)5/h18H,8-12H2,1-7H3 |
| InChIKey | RVHDXLWIXIHQAV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|