C22H42O6 — CID 18172288
2,2-bis(2,4,4-trimethylpentan-2-yl)hexanediperoxoic acid (PubChem CID 18172288) has the molecular formula C22H42O6 and a molecular weight of 402.57 g/mol. Its IUPAC name is 2,2-bis(2,4,4-trimethylpentan-2-yl)hexanediperoxoic acid.
| Compound Name | 2,2-bis(2,4,4-trimethylpentan-2-yl)hexanediperoxoic acid |
|---|---|
| PubChem CID | 18172288 |
| Molecular Formula | C22H42O6 |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 2,2-bis(2,4,4-trimethylpentan-2-yl)hexanediperoxoic acid |
| SMILES | CC(C)(C)CC(C)(C)C(CCCC(=O)OO)(C(=O)OO)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C22H42O6/c1-18(2,3)14-20(7,8)22(17(24)28-26,13-11-12-16(23)27-25)21(9,10)15-19(4,5)6/h25-26H,11-15H2,1-10H3 |
| InChIKey | FDPIWRRAORQLNL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|