C26H33N3O2 — CID 139535805
2-N-[(1S)-1-(methoxymethoxy)-1-(4-methylphenyl)propan-2-yl]-3-N-[2-(4-methylphenyl)ethyl]pyridine-2,3-diamine (PubChem CID 139535805) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-N-[(1S)-1-(methoxymethoxy)-1-(4-methylphenyl)propan-2-yl]-3-N-[2-(4-methylphenyl)ethyl]pyridine-2,3-diamine.
| Compound Name | 2-N-[(1S)-1-(methoxymethoxy)-1-(4-methylphenyl)propan-2-yl]-3-N-[2-(4-methylphenyl)ethyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 139535805 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 2-N-[(1S)-1-(methoxymethoxy)-1-(4-methylphenyl)propan-2-yl]-3-N-[2-(4-methylphenyl)ethyl]pyridine-2,3-diamine |
| SMILES | COCO[C@@H](c1ccc(C)cc1)C(C)Nc1ncccc1NCCc1ccc(C)cc1 |
| InChI | InChI=1S/C26H33N3O2/c1-19-7-11-22(12-8-19)15-17-27-24-6-5-16-28-26(24)29-21(3)25(31-18-30-4)23-13-9-20(2)10-14-23/h5-14,16,21,25,27H,15,17-18H2,1-4H3,(H,28,29)/t21?,25-/m1/s1 |
| InChIKey | VSXCENZJHIVMOG-UIDYPRJRSA-N |
| XLogP | 5.52 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|