C24H28N4O — CID 44573576
4-N,4-N-dimethyl-1-N-[5-[[(2S)-2-phenylmorpholin-4-yl]methyl]-2-pyridinyl]benzene-1,4-diamine (PubChem CID 44573576) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-[5-[[(2S)-2-phenylmorpholin-4-yl]methyl]-2-pyridinyl]benzene-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-1-N-[5-[[(2S)-2-phenylmorpholin-4-yl]methyl]-2-pyridinyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 44573576 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-[5-[[(2S)-2-phenylmorpholin-4-yl]methyl]-2-pyridinyl]benzene-1,4-diamine |
| SMILES | CN(C)c1ccc(Nc2ccc(CN3CCO[C@@H](c4ccccc4)C3)cn2)cc1 |
| InChI | InChI=1S/C24H28N4O/c1-27(2)22-11-9-21(10-12-22)26-24-13-8-19(16-25-24)17-28-14-15-29-23(18-28)20-6-4-3-5-7-20/h3-13,16,23H,14-15,17-18H2,1-2H3,(H,25,26)/t23-/m1/s1 |
| InChIKey | IWVCRBNZZHWEBR-HSZRJFAPSA-N |
| XLogP | 4.46 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|