C21H21N5O3S — CID 139536074
N-[4-(2,2-dimethylhydrazinyl)-3,4-dioxo-1-phenylbutan-2-yl]-4-phenyl-1,2,5-thiadiazole-3-carboxamide (PubChem CID 139536074) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is N-[4-(2,2-dimethylhydrazinyl)-3,4-dioxo-1-phenylbutan-2-yl]-4-phenyl-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-[4-(2,2-dimethylhydrazinyl)-3,4-dioxo-1-phenylbutan-2-yl]-4-phenyl-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 139536074 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[4-(2,2-dimethylhydrazinyl)-3,4-dioxo-1-phenylbutan-2-yl]-4-phenyl-1,2,5-thiadiazole-3-carboxamide |
| SMILES | CN(C)NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1nsnc1-c1ccccc1 |
| InChI | InChI=1S/C21H21N5O3S/c1-26(2)23-21(29)19(27)16(13-14-9-5-3-6-10-14)22-20(28)18-17(24-30-25-18)15-11-7-4-8-12-15/h3-12,16H,13H2,1-2H3,(H,22,28)(H,23,29) |
| InChIKey | OHTGGIKLDUSMFL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|