C20H13F2N3O6S — CID 155479028
3-[[4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1,2,5-thiadiazole-3-carbonyl]amino]-2-oxo-4-phenylbutanoic acid (PubChem CID 155479028) has the molecular formula C20H13F2N3O6S and a molecular weight of 461.40 g/mol. Its IUPAC name is 3-[[4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1,2,5-thiadiazole-3-carbonyl]amino]-2-oxo-4-phenylbutanoic acid.
| Compound Name | 3-[[4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1,2,5-thiadiazole-3-carbonyl]amino]-2-oxo-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 155479028 |
| Molecular Formula | C20H13F2N3O6S |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 3-[[4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1,2,5-thiadiazole-3-carbonyl]amino]-2-oxo-4-phenylbutanoic acid |
| SMILES | O=C(O)C(=O)C(Cc1ccccc1)NC(=O)c1nsnc1-c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C20H13F2N3O6S/c21-20(22)30-13-8-4-7-11(17(13)31-20)14-15(25-32-24-14)18(27)23-12(16(26)19(28)29)9-10-5-2-1-3-6-10/h1-8,12H,9H2,(H,23,27)(H,28,29) |
| InChIKey | QOVSLJBCJQCUHU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|