C23H17F2N3O6 — CID 153385918
acetylene;N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-(2,2-difluoro-1,3-benzodioxol-4-yl)-1,2-oxazole-4-carboxamide (PubChem CID 153385918) has the molecular formula C23H17F2N3O6 and a molecular weight of 469.40 g/mol. Its IUPAC name is acetylene;N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-(2,2-difluoro-1,3-benzodioxol-4-yl)-1,2-oxazole-4-carboxamide.
| Compound Name | acetylene;N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-(2,2-difluoro-1,3-benzodioxol-4-yl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 153385918 |
| Molecular Formula | C23H17F2N3O6 |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | acetylene;N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-(2,2-difluoro-1,3-benzodioxol-4-yl)-1,2-oxazole-4-carboxamide |
| SMILES | C#C.NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1cnoc1-c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C21H15F2N3O6.C2H2/c22-21(23)30-15-8-4-7-12(18(15)31-21)17-13(10-25-32-17)20(29)26-14(16(27)19(24)28)9-11-5-2-1-3-6-11;1-2/h1-8,10,14H,9H2,(H2,24,28)(H,26,29);1-2H |
| InChIKey | OWAAKUPEXUIEFX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|