C20H18N4O4 — CID 153386152
N-(1-amino-1,2-dioxo-5-phenylpentan-3-yl)-5-pyridin-2-yl-1,2-oxazole-4-carboxamide (PubChem CID 153386152) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is N-(1-amino-1,2-dioxo-5-phenylpentan-3-yl)-5-pyridin-2-yl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(1-amino-1,2-dioxo-5-phenylpentan-3-yl)-5-pyridin-2-yl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 153386152 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-(1-amino-1,2-dioxo-5-phenylpentan-3-yl)-5-pyridin-2-yl-1,2-oxazole-4-carboxamide |
| SMILES | NC(=O)C(=O)C(CCc1ccccc1)NC(=O)c1cnoc1-c1ccccn1 |
| InChI | InChI=1S/C20H18N4O4/c21-19(26)17(25)15(10-9-13-6-2-1-3-7-13)24-20(27)14-12-23-28-18(14)16-8-4-5-11-22-16/h1-8,11-12,15H,9-10H2,(H2,21,26)(H,24,27) |
| InChIKey | JQSXDWMPWDEIGJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|