C20H23N7O — CID 139536703
2-[3-[(4aS,7aS)-1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-4-yl)phenol (PubChem CID 139536703) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-[3-[(4aS,7aS)-1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-4-yl)phenol.
| Compound Name | 2-[3-[(4aS,7aS)-1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-4-yl)phenol |
|---|---|
| PubChem CID | 139536703 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-[3-[(4aS,7aS)-1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-4-yl)phenol |
| SMILES | CN1CCC[C@H]2CN(c3ncc(-c4ccc(-c5cn[nH]c5)cc4O)nn3)C[C@H]21 |
| InChI | InChI=1S/C20H23N7O/c1-26-6-2-3-14-11-27(12-18(14)26)20-21-10-17(24-25-20)16-5-4-13(7-19(16)28)15-8-22-23-9-15/h4-5,7-10,14,18,28H,2-3,6,11-12H2,1H3,(H,22,23)/t14-,18+/m0/s1 |
| InChIKey | MWYQONMTNSEHIO-KBXCAEBGSA-N |
| XLogP | 2.16 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |