C19H21N7O — CID 156887515
2-[3-[(3S,5R)-3-ethenyl-5-methylpiperazin-1-yl]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-4-yl)phenol (PubChem CID 156887515) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is 2-[3-[(3S,5R)-3-ethenyl-5-methylpiperazin-1-yl]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-4-yl)phenol.
| Compound Name | 2-[3-[(3S,5R)-3-ethenyl-5-methylpiperazin-1-yl]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-4-yl)phenol |
|---|---|
| PubChem CID | 156887515 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-[3-[(3S,5R)-3-ethenyl-5-methylpiperazin-1-yl]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-4-yl)phenol |
| SMILES | C=C[C@H]1CN(c2ncc(-c3ccc(-c4cn[nH]c4)cc3O)nn2)C[C@@H](C)N1 |
| InChI | InChI=1S/C19H21N7O/c1-3-15-11-26(10-12(2)23-15)19-20-9-17(24-25-19)16-5-4-13(6-18(16)27)14-7-21-22-8-14/h3-9,12,15,23,27H,1,10-11H2,2H3,(H,21,22)/t12-,15+/m1/s1 |
| InChIKey | TVQWLXXEDOSKJT-DOMZBBRYSA-N |
| XLogP | 1.99 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|