C21H29Cl2N7O2 — CID 139536735
(3S,4S)-4-[[6-[2-hydroxy-4-(1H-pyrazol-4-yl)phenyl]-1,2,4-triazin-3-yl]amino]-2,2,6,6-tetramethylpiperidin-3-ol;dihydrochloride (PubChem CID 139536735) has the molecular formula C21H29Cl2N7O2 and a molecular weight of 482.42 g/mol. Its IUPAC name is (3S,4S)-4-[[6-[2-hydroxy-4-(1H-pyrazol-4-yl)phenyl]-1,2,4-triazin-3-yl]amino]-2,2,6,6-tetramethylpiperidin-3-ol;dihydrochloride.
| Compound Name | (3S,4S)-4-[[6-[2-hydroxy-4-(1H-pyrazol-4-yl)phenyl]-1,2,4-triazin-3-yl]amino]-2,2,6,6-tetramethylpiperidin-3-ol;dihydrochloride |
|---|---|
| PubChem CID | 139536735 |
| Molecular Formula | C21H29Cl2N7O2 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (3S,4S)-4-[[6-[2-hydroxy-4-(1H-pyrazol-4-yl)phenyl]-1,2,4-triazin-3-yl]amino]-2,2,6,6-tetramethylpiperidin-3-ol;dihydrochloride |
| SMILES | CC1(C)C[C@H](Nc2ncc(-c3ccc(-c4cn[nH]c4)cc3O)nn2)[C@H](O)C(C)(C)N1.Cl.Cl |
| InChI | InChI=1S/C21H27N7O2.2ClH/c1-20(2)8-15(18(30)21(3,4)28-20)25-19-22-11-16(26-27-19)14-6-5-12(7-17(14)29)13-9-23-24-10-13;;/h5-7,9-11,15,18,28-30H,8H2,1-4H3,(H,23,24)(H,22,25,27);2*1H/t15-,18-;;/m0../s1 |
| InChIKey | GJWKZJAPBBAQGD-WQPBPYDNSA-N |
| XLogP | 3.17 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |