C22H28N6O2 — CID 139536618
5-(2-methyl-1,3-oxazol-5-yl)-2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol (PubChem CID 139536618) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 5-(2-methyl-1,3-oxazol-5-yl)-2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol.
| Compound Name | 5-(2-methyl-1,3-oxazol-5-yl)-2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 139536618 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 5-(2-methyl-1,3-oxazol-5-yl)-2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
| SMILES | Cc1ncc(-c2ccc(-c3cnc(NC4CC(C)(C)NC(C)(C)C4)nn3)c(O)c2)o1 |
| InChI | InChI=1S/C22H28N6O2/c1-13-23-12-19(30-13)14-6-7-16(18(29)8-14)17-11-24-20(27-26-17)25-15-9-21(2,3)28-22(4,5)10-15/h6-8,11-12,15,28-29H,9-10H2,1-5H3,(H,24,25,27) |
| InChIKey | OUGRYZLTFNOXEE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |