C25H31N5O3 — CID 139535418
formic acid;5-pyridin-2-yl-2-[5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrazin-2-yl]phenol (PubChem CID 139535418) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is formic acid;5-pyridin-2-yl-2-[5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrazin-2-yl]phenol.
| Compound Name | formic acid;5-pyridin-2-yl-2-[5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrazin-2-yl]phenol |
|---|---|
| PubChem CID | 139535418 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | formic acid;5-pyridin-2-yl-2-[5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrazin-2-yl]phenol |
| SMILES | CC1(C)CC(Nc2cnc(-c3ccc(-c4ccccn4)cc3O)cn2)CC(C)(C)N1.O=CO |
| InChI | InChI=1S/C24H29N5O.CH2O2/c1-23(2)12-17(13-24(3,4)29-23)28-22-15-26-20(14-27-22)18-9-8-16(11-21(18)30)19-7-5-6-10-25-19;2-1-3/h5-11,14-15,17,29-30H,12-13H2,1-4H3,(H,27,28);1H,(H,2,3) |
| InChIKey | BGNLMMSZNFUPNO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|