C24H31N7O — CID 153382865
2-[5-methanimidoyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-5-(1-methylpyrazol-4-yl)phenol (PubChem CID 153382865) has the molecular formula C24H31N7O and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-[5-methanimidoyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-5-(1-methylpyrazol-4-yl)phenol.
| Compound Name | 2-[5-methanimidoyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-5-(1-methylpyrazol-4-yl)phenol |
|---|---|
| PubChem CID | 153382865 |
| Molecular Formula | C24H31N7O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 2-[5-methanimidoyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-5-(1-methylpyrazol-4-yl)phenol |
| SMILES | [H]/N=C/c1cc(-c2ccc(-c3cnn(C)c3)cc2O)nnc1NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C24H31N7O/c1-23(2)10-18(11-24(3,4)30-23)27-22-16(12-25)8-20(28-29-22)19-7-6-15(9-21(19)32)17-13-26-31(5)14-17/h6-9,12-14,18,25,30,32H,10-11H2,1-5H3,(H,27,29)/b25-12+ |
| InChIKey | OGPNGYYHJMHKQY-BRJLIKDPSA-N |
| XLogP | 3.97 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|