C24H31N7O3 — CID 175084825
formic acid;5-(pyridin-3-ylamino)-2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol (PubChem CID 175084825) has the molecular formula C24H31N7O3 and a molecular weight of 465.56 g/mol. Its IUPAC name is formic acid;5-(pyridin-3-ylamino)-2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol.
| Compound Name | formic acid;5-(pyridin-3-ylamino)-2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 175084825 |
| Molecular Formula | C24H31N7O3 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | formic acid;5-(pyridin-3-ylamino)-2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
| SMILES | CC1(C)CC(Nc2ncc(-c3ccc(Nc4cccnc4)cc3O)nn2)CC(C)(C)N1.O=CO |
| InChI | InChI=1S/C23H29N7O.CH2O2/c1-22(2)11-17(12-23(3,4)30-22)27-21-25-14-19(28-29-21)18-8-7-15(10-20(18)31)26-16-6-5-9-24-13-16;2-1-3/h5-10,13-14,17,26,30-31H,11-12H2,1-4H3,(H,25,27,29);1H,(H,2,3) |
| InChIKey | RVOQVGGZVAYOBX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 145.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|