C14H12N2O3 — CID 69186238
2-(1,3-dioxol-4-yl)-5-(pyridin-3-ylamino)phenol (PubChem CID 69186238) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-(1,3-dioxol-4-yl)-5-(pyridin-3-ylamino)phenol.
| Compound Name | 2-(1,3-dioxol-4-yl)-5-(pyridin-3-ylamino)phenol |
|---|---|
| PubChem CID | 69186238 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-(1,3-dioxol-4-yl)-5-(pyridin-3-ylamino)phenol |
| SMILES | Oc1cc(Nc2cccnc2)ccc1C1=COCO1 |
| InChI | InChI=1S/C14H12N2O3/c17-13-6-10(16-11-2-1-5-15-7-11)3-4-12(13)14-8-18-9-19-14/h1-8,16-17H,9H2 |
| InChIKey | XKJKMQLUDZWZAY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |