C12H12N2O2 — CID 82674879
2-[(pyridin-3-ylamino)methyl]benzene-1,4-diol (PubChem CID 82674879) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-[(pyridin-3-ylamino)methyl]benzene-1,4-diol.
| Compound Name | 2-[(pyridin-3-ylamino)methyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 82674879 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-[(pyridin-3-ylamino)methyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(CNc2cccnc2)c1 |
| InChI | InChI=1S/C12H12N2O2/c15-11-3-4-12(16)9(6-11)7-14-10-2-1-5-13-8-10/h1-6,8,14-16H,7H2 |
| InChIKey | WXABFZRVPXZOSE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|